About 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid
3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid (PubChem CID 65298233) has the molecular formula C12H12N2O4
and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid |
| PubChem CID | 65298233 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid |
| SMILES | CC1(C)CC(=O)N(c2cnccc2C(=O)O)C1=O |
| InChI | InChI=1S/C12H12N2O4/c1-12(2)5-9(15)14(11(12)18)8-6-13-4-3-7(8)10(16)17/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | QONHWNCTGIAQGQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid?
The IUPAC name of 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid (CID 65298233) is 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid.
What is the SMILES notation for 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid?
The canonical SMILES for 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid is CC1(C)CC(=O)N(c2cnccc2C(=O)O)C1=O.
What is the InChIKey of 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid?
The InChIKey is QONHWNCTGIAQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-12(2)5-9(15)14(11(12)18)8-6-13-4-3-7(8)10(16)17/h3-4,6H,5H2,1-2H3,(H,16,17).
What are the key properties of 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid?
3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid has a molecular weight of 248.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pyridine-4-carboxylic acid is sourced from PubChem (CID 65298233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).