About 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide
2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide (PubChem CID 65298243) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide.
Molecular Properties
| Compound Name | 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide |
| PubChem CID | 65298243 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide |
| SMILES | CCCC(C(N)=S)N1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C11H18N2O2S/c1-4-5-7(9(12)16)13-8(14)6-11(2,3)10(13)15/h7H,4-6H2,1-3H3,(H2,12,16) |
| InChIKey | ZKWWFZURMGIYKJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide?
The IUPAC name of 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide (CID 65298243) is 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide.
What is the SMILES notation for 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide?
The canonical SMILES for 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide is CCCC(C(N)=S)N1C(=O)CC(C)(C)C1=O.
What is the InChIKey of 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide?
The InChIKey is ZKWWFZURMGIYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-4-5-7(9(12)16)13-8(14)6-11(2,3)10(13)15/h7H,4-6H2,1-3H3,(H2,12,16).
What are the key properties of 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide?
2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide has a molecular weight of 242.34 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)pentanethioamide is sourced from PubChem (CID 65298243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).