C26H32N4O3S — CID 6529977
(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(2-ethoxyphenyl)imino-3-(2-morpholin-4-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 6529977) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(2-ethoxyphenyl)imino-3-(2-morpholin-4-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(2-ethoxyphenyl)imino-3-(2-morpholin-4-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6529977 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(2-ethoxyphenyl)imino-3-(2-morpholin-4-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccccc1/N=C1/S/C(=C\c2ccc(N(C)C)cc2)C(=O)N1CCN1CCOCC1 |
| InChI | InChI=1S/C26H32N4O3S/c1-4-33-23-8-6-5-7-22(23)27-26-30(14-13-29-15-17-32-18-16-29)25(31)24(34-26)19-20-9-11-21(12-10-20)28(2)3/h5-12,19H,4,13-18H2,1-3H3/b24-19-,27-26+ |
| InChIKey | JBSLJDKPSGDMOK-WZDJMGEGSA-N |
| XLogP | 4.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|