C14H26N2O2 — CID 65301274
1-[2-(ethylamino)-3,3-dimethylbutyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 65301274) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[2-(ethylamino)-3,3-dimethylbutyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(ethylamino)-3,3-dimethylbutyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 65301274 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-[2-(ethylamino)-3,3-dimethylbutyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CCNC(CN1C(=O)CC(C)(C)C1=O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-7-15-10(13(2,3)4)9-16-11(17)8-14(5,6)12(16)18/h10,15H,7-9H2,1-6H3 |
| InChIKey | LVRSUZKLQWZGED-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|