About methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate
methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate (PubChem CID 65301393) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate |
| PubChem CID | 65301393 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate |
| SMILES | COC(=O)C(C)(N)CCN1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C12H20N2O4/c1-11(2)7-8(15)14(9(11)16)6-5-12(3,13)10(17)18-4/h5-7,13H2,1-4H3 |
| InChIKey | NHJWOTZDHIGJQS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate?
The IUPAC name of methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate (CID 65301393) is methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate.
What is the SMILES notation for methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate?
The canonical SMILES for methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate is COC(=O)C(C)(N)CCN1C(=O)CC(C)(C)C1=O.
What is the InChIKey of methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate?
The InChIKey is NHJWOTZDHIGJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-11(2)7-8(15)14(9(11)16)6-5-12(3,13)10(17)18-4/h5-7,13H2,1-4H3.
What are the key properties of methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate?
methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate has a molecular weight of 256.30 g/mol, XLogP of 0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbutanoate is sourced from PubChem (CID 65301393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).