About ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate
ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate (PubChem CID 65301588) has the molecular formula C14H22N2O4
and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate |
| PubChem CID | 65301588 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate |
| SMILES | CCOC(=O)C(N)(CN1C(=O)CC(C)(C)C1=O)C1CC1 |
| InChI | InChI=1S/C14H22N2O4/c1-4-20-12(19)14(15,9-5-6-9)8-16-10(17)7-13(2,3)11(16)18/h9H,4-8,15H2,1-3H3 |
| InChIKey | YLVMFEITSGXGGP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate?
The IUPAC name of ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate (CID 65301588) is ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate.
What is the SMILES notation for ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate?
The canonical SMILES for ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate is CCOC(=O)C(N)(CN1C(=O)CC(C)(C)C1=O)C1CC1.
What is the InChIKey of ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate?
The InChIKey is YLVMFEITSGXGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4/c1-4-20-12(19)14(15,9-5-6-9)8-16-10(17)7-13(2,3)11(16)18/h9H,4-8,15H2,1-3H3.
What are the key properties of ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate?
ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate has a molecular weight of 282.34 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-2-cyclopropyl-3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoate is sourced from PubChem (CID 65301588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).