About ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate
ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate (PubChem CID 65301592) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate |
| PubChem CID | 65301592 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate |
| SMILES | CCCNC(CCN1C(=O)CC(C)(C)C1=O)C(=O)OCC |
| InChI | InChI=1S/C15H26N2O4/c1-5-8-16-11(13(19)21-6-2)7-9-17-12(18)10-15(3,4)14(17)20/h11,16H,5-10H2,1-4H3 |
| InChIKey | AAJFSUPMFJNMAE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate?
The IUPAC name of ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate (CID 65301592) is ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate.
What is the SMILES notation for ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate?
The canonical SMILES for ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate is CCCNC(CCN1C(=O)CC(C)(C)C1=O)C(=O)OCC.
What is the InChIKey of ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate?
The InChIKey is AAJFSUPMFJNMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O4/c1-5-8-16-11(13(19)21-6-2)7-9-17-12(18)10-15(3,4)14(17)20/h11,16H,5-10H2,1-4H3.
What are the key properties of ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate?
ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate has a molecular weight of 298.38 g/mol, XLogP of 1.09, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(propylamino)butanoate is sourced from PubChem (CID 65301592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).