C16H15NO4 — CID 65301721
1-[2-(1-benzofuran-3-yl)-2-oxoethyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 65301721) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-3-yl)-2-oxoethyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(1-benzofuran-3-yl)-2-oxoethyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 65301721 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[2-(1-benzofuran-3-yl)-2-oxoethyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(CC(=O)c2coc3ccccc23)C1=O |
| InChI | InChI=1S/C16H15NO4/c1-16(2)7-14(19)17(15(16)20)8-12(18)11-9-21-13-6-4-3-5-10(11)13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | PWXSDMULTGPUJE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|