C13H19Cl2NO — CID 65302872
4-(2,5-dichlorophenyl)-N-(2-methoxyethyl)butan-1-amine (PubChem CID 65302872) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-(2,5-dichlorophenyl)-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 65302872 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-N-(2-methoxyethyl)butan-1-amine |
| SMILES | COCCNCCCCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-17-9-8-16-7-3-2-4-11-10-12(14)5-6-13(11)15/h5-6,10,16H,2-4,7-9H2,1H3 |
| InChIKey | WQYQLLKNAKIVDG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|