About 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine
4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine (PubChem CID 65306196) has the molecular formula C12H19Cl2NS
and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine |
| PubChem CID | 65306196 |
| Molecular Formula | C12H19Cl2NS |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine |
| SMILES | CCNCC(C)(C)CCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H19Cl2NS/c1-4-15-8-12(2,3)6-5-9-7-10(13)16-11(9)14/h7,15H,4-6,8H2,1-3H3 |
| InChIKey | HABDEZWNCUOITF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine?
The IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine (CID 65306196) is 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine?
The canonical SMILES for 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine is CCNCC(C)(C)CCc1cc(Cl)sc1Cl.
What is the InChIKey of 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine?
The InChIKey is HABDEZWNCUOITF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19Cl2NS/c1-4-15-8-12(2,3)6-5-9-7-10(13)16-11(9)14/h7,15H,4-6,8H2,1-3H3.
What are the key properties of 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine?
4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine has a molecular weight of 280.26 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 65306196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).