About 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline
3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline (PubChem CID 653069) has the molecular formula C14H12FN3
and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
| PubChem CID | 653069 |
| Molecular Formula | C14H12FN3 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
| SMILES | Fc1cccc(NCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C14H12FN3/c15-11-4-3-5-12(8-11)16-9-13-10-18-7-2-1-6-14(18)17-13/h1-8,10,16H,9H2 |
| InChIKey | GVMHVUWEQLFKAJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline?
The IUPAC name of 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline (CID 653069) is 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline.
What is the SMILES notation for 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline?
The canonical SMILES for 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline is Fc1cccc(NCc2cn3ccccc3n2)c1.
What is the InChIKey of 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline?
The InChIKey is GVMHVUWEQLFKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3/c15-11-4-3-5-12(8-11)16-9-13-10-18-7-2-1-6-14(18)17-13/h1-8,10,16H,9H2.
What are the key properties of 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline?
3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline has a molecular weight of 241.27 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline is sourced from PubChem (CID 653069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).