About N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine
N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine (PubChem CID 65308480) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine |
| PubChem CID | 65308480 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine |
| SMILES | Cc1ccc(C)c(CCC(C)(C)CNC2CC2)c1 |
| InChI | InChI=1S/C17H27N/c1-13-5-6-14(2)15(11-13)9-10-17(3,4)12-18-16-7-8-16/h5-6,11,16,18H,7-10,12H2,1-4H3 |
| InChIKey | VYLFSJGXFALOBP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine?
The IUPAC name of N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine (CID 65308480) is N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine.
What is the SMILES notation for N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine?
The canonical SMILES for N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine is Cc1ccc(C)c(CCC(C)(C)CNC2CC2)c1.
What is the InChIKey of N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine?
The InChIKey is VYLFSJGXFALOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N/c1-13-5-6-14(2)15(11-13)9-10-17(3,4)12-18-16-7-8-16/h5-6,11,16,18H,7-10,12H2,1-4H3.
What are the key properties of N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine?
N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine has a molecular weight of 245.41 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,5-dimethylphenyl)-2,2-dimethylbutyl]cyclopropanamine is sourced from PubChem (CID 65308480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).