C13H16BrNO — CID 65309140
(5-bromo-2-methylphenyl)-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 65309140) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is (5-bromo-2-methylphenyl)-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (5-bromo-2-methylphenyl)-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 65309140 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (5-bromo-2-methylphenyl)-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | Cc1ccc(Br)cc1C(=O)N1CCC(C)C1 |
| InChI | InChI=1S/C13H16BrNO/c1-9-5-6-15(8-9)13(16)12-7-11(14)4-3-10(12)2/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | NSMFABAAVZZZAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |