C32H29N3O7S — CID 6530978
ethyl (2Z)-2-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6530978) has the molecular formula C32H29N3O7S and a molecular weight of 599.67 g/mol. Its IUPAC name is ethyl (2Z)-2-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-2-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6530978 |
| Molecular Formula | C32H29N3O7S |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | ethyl (2Z)-2-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc(OCc4ccccc4[N+](=O)[O-])c(OCC)c3)c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C32H29N3O7S/c1-4-40-26-17-21(15-16-25(26)42-19-23-13-9-10-14-24(23)35(38)39)18-27-30(36)34-29(22-11-7-6-8-12-22)28(31(37)41-5-2)20(3)33-32(34)43-27/h6-18,29H,4-5,19H2,1-3H3/b27-18- |
| InChIKey | QRYAATDOXSECPJ-IMRQLAEWSA-N |
| XLogP | 4.68 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|