C18H24N2O — CID 65309933
[5-(3-aminoprop-1-ynyl)-2-methylphenyl]-(3,3-dimethylpiperidin-1-yl)methanone (PubChem CID 65309933) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [5-(3-aminoprop-1-ynyl)-2-methylphenyl]-(3,3-dimethylpiperidin-1-yl)methanone.
| Compound Name | [5-(3-aminoprop-1-ynyl)-2-methylphenyl]-(3,3-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 65309933 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [5-(3-aminoprop-1-ynyl)-2-methylphenyl]-(3,3-dimethylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(C#CCN)cc1C(=O)N1CCCC(C)(C)C1 |
| InChI | InChI=1S/C18H24N2O/c1-14-7-8-15(6-4-10-19)12-16(14)17(21)20-11-5-9-18(2,3)13-20/h7-8,12H,5,9-11,13,19H2,1-3H3 |
| InChIKey | VJMQMVOBNOOOCL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|