About 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide
7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide (PubChem CID 65309948) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide |
| PubChem CID | 65309948 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide |
| SMILES | Nc1cccc2cc(C(=O)NC(CO)CO)[nH]c12 |
| InChI | InChI=1S/C12H15N3O3/c13-9-3-1-2-7-4-10(15-11(7)9)12(18)14-8(5-16)6-17/h1-4,8,15-17H,5-6,13H2,(H,14,18) |
| InChIKey | GDCCZNHPQWZXNW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide?
The IUPAC name of 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide (CID 65309948) is 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide.
What is the SMILES notation for 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide?
The canonical SMILES for 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide is Nc1cccc2cc(C(=O)NC(CO)CO)[nH]c12.
What is the InChIKey of 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide?
The InChIKey is GDCCZNHPQWZXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c13-9-3-1-2-7-4-10(15-11(7)9)12(18)14-8(5-16)6-17/h1-4,8,15-17H,5-6,13H2,(H,14,18).
What are the key properties of 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide?
7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide has a molecular weight of 249.27 g/mol, XLogP of -0.17, 4 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-N-(1,3-dihydroxypropan-2-yl)-1H-indole-2-carboxamide is sourced from PubChem (CID 65309948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).