C16H19N5OS — CID 653100
2,2-dimethyl-N-[2-methyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]propanamide (PubChem CID 653100) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-methyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-methyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 653100 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2,2-dimethyl-N-[2-methyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]propanamide |
| SMILES | Cc1cc(-c2nn3c(C)nnc3s2)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H19N5OS/c1-9-8-11(6-7-12(9)17-14(22)16(3,4)5)13-20-21-10(2)18-19-15(21)23-13/h6-8H,1-5H3,(H,17,22) |
| InChIKey | NUJGHTKRCPCWML-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |