C8H13N3O2 — CID 65312354
2-(pyrazin-2-ylmethylamino)propane-1,3-diol (PubChem CID 65312354) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(pyrazin-2-ylmethylamino)propane-1,3-diol.
| Compound Name | 2-(pyrazin-2-ylmethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 65312354 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-(pyrazin-2-ylmethylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCc1cnccn1 |
| InChI | InChI=1S/C8H13N3O2/c12-5-8(6-13)11-4-7-3-9-1-2-10-7/h1-3,8,11-13H,4-6H2 |
| InChIKey | XMKVECLRKAITLC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |