C13H21NO3 — CID 65312708
2-[(4-propoxyphenyl)methylamino]propane-1,3-diol (PubChem CID 65312708) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[(4-propoxyphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(4-propoxyphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65312708 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(4-propoxyphenyl)methylamino]propane-1,3-diol |
| SMILES | CCCOc1ccc(CNC(CO)CO)cc1 |
| InChI | InChI=1S/C13H21NO3/c1-2-7-17-13-5-3-11(4-6-13)8-14-12(9-15)10-16/h3-6,12,14-16H,2,7-10H2,1H3 |
| InChIKey | CYRJJPPSVDQHAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |