C12H17NO5 — CID 65313044
N-(1,3-dihydroxypropan-2-yl)-2-(4-methoxyphenoxy)acetamide (PubChem CID 65313044) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 65313044 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)NC(CO)CO)cc1 |
| InChI | InChI=1S/C12H17NO5/c1-17-10-2-4-11(5-3-10)18-8-12(16)13-9(6-14)7-15/h2-5,9,14-15H,6-8H2,1H3,(H,13,16) |
| InChIKey | ZAWBWFZOGAKTOI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |