About N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide
N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 65313063) has the molecular formula C9H14N2O4S
and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 65313063 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NC(CO)CO |
| InChI | InChI=1S/C9H14N2O4S/c1-6-5-16-9(15)11(6)2-8(14)10-7(3-12)4-13/h5,7,12-13H,2-4H2,1H3,(H,10,14) |
| InChIKey | LOOZRFOJHHUPDR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The IUPAC name of N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (CID 65313063) is N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide is Cc1csc(=O)n1CC(=O)NC(CO)CO.
What is the InChIKey of N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The InChIKey is LOOZRFOJHHUPDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4S/c1-6-5-16-9(15)11(6)2-8(14)10-7(3-12)4-13/h5,7,12-13H,2-4H2,1H3,(H,10,14).
What are the key properties of N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide?
N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide has a molecular weight of 246.29 g/mol, XLogP of -1.31, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydroxypropan-2-yl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 65313063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).