About 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one
1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one (PubChem CID 65313305) has the molecular formula C8H17N3O3
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one |
| PubChem CID | 65313305 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNC(CO)CO |
| InChI | InChI=1S/C8H17N3O3/c12-5-7(6-13)9-1-3-11-4-2-10-8(11)14/h7,9,12-13H,1-6H2,(H,10,14) |
| InChIKey | OAJJEKOBEXDEMJ-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one?
The IUPAC name of 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one (CID 65313305) is 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one is O=C1NCCN1CCNC(CO)CO.
What is the InChIKey of 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one?
The InChIKey is OAJJEKOBEXDEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O3/c12-5-7(6-13)9-1-3-11-4-2-10-8(11)14/h7,9,12-13H,1-6H2,(H,10,14).
What are the key properties of 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one?
1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one has a molecular weight of 203.24 g/mol, XLogP of -2.05, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]imidazolidin-2-one is sourced from PubChem (CID 65313305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).