C11H22N2O3 — CID 65313308
N-cyclohexyl-2-(1,3-dihydroxypropan-2-ylamino)acetamide (PubChem CID 65313308) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,3-dihydroxypropan-2-ylamino)acetamide.
| Compound Name | N-cyclohexyl-2-(1,3-dihydroxypropan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 65313308 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-cyclohexyl-2-(1,3-dihydroxypropan-2-ylamino)acetamide |
| SMILES | O=C(CNC(CO)CO)NC1CCCCC1 |
| InChI | InChI=1S/C11H22N2O3/c14-7-10(8-15)12-6-11(16)13-9-4-2-1-3-5-9/h9-10,12,14-15H,1-8H2,(H,13,16) |
| InChIKey | XNUDJRAPDSGENZ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |