About 2-(2,2-difluoroethylamino)propane-1,3-diol
2-(2,2-difluoroethylamino)propane-1,3-diol (PubChem CID 65314249) has the molecular formula C5H11F2NO2
and a molecular weight of 155.14 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethylamino)propane-1,3-diol |
| PubChem CID | 65314249 |
| Molecular Formula | C5H11F2NO2 |
| Molecular Weight | 155.14 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-(2,2-difluoroethylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCC(F)F |
| InChI | InChI=1S/C5H11F2NO2/c6-5(7)1-8-4(2-9)3-10/h4-5,8-10H,1-3H2 |
| InChIKey | WCPYUINUDSNBLW-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.14 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-difluoroethylamino)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethylamino)propane-1,3-diol?
The IUPAC name of 2-(2,2-difluoroethylamino)propane-1,3-diol (CID 65314249) is 2-(2,2-difluoroethylamino)propane-1,3-diol.
What is the SMILES notation for 2-(2,2-difluoroethylamino)propane-1,3-diol?
The canonical SMILES for 2-(2,2-difluoroethylamino)propane-1,3-diol is OCC(CO)NCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethylamino)propane-1,3-diol?
The InChIKey is WCPYUINUDSNBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F2NO2/c6-5(7)1-8-4(2-9)3-10/h4-5,8-10H,1-3H2.
What are the key properties of 2-(2,2-difluoroethylamino)propane-1,3-diol?
2-(2,2-difluoroethylamino)propane-1,3-diol has a molecular weight of 155.14 g/mol, XLogP of -0.81, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylamino)propane-1,3-diol is sourced from PubChem (CID 65314249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).