C9H18N2O3 — CID 65314727
N-(1,3-dihydroxypropan-2-yl)piperidine-4-carboxamide (PubChem CID 65314727) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 65314727 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(NC(CO)CO)C1CCNCC1 |
| InChI | InChI=1S/C9H18N2O3/c12-5-8(6-13)11-9(14)7-1-3-10-4-2-7/h7-8,10,12-13H,1-6H2,(H,11,14) |
| InChIKey | GJBQWHYVSNHLHN-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |