About 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide
2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 65314751) has the molecular formula C7H11ClN2O4S2
and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 65314751 |
| Molecular Formula | C7H11ClN2O4S2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NC(CO)CO |
| InChI | InChI=1S/C7H11ClN2O4S2/c1-4-6(15-7(8)9-4)16(13,14)10-5(2-11)3-12/h5,10-12H,2-3H2,1H3 |
| InChIKey | ZOWCSXSCQXAFKX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide (CID 65314751) is 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide is Cc1nc(Cl)sc1S(=O)(=O)NC(CO)CO.
What is the InChIKey of 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is ZOWCSXSCQXAFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O4S2/c1-4-6(15-7(8)9-4)16(13,14)10-5(2-11)3-12/h5,10-12H,2-3H2,1H3.
What are the key properties of 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide?
2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 286.76 g/mol, XLogP of -0.26, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 65314751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).