C15H23NO3 — CID 65315116
N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-phenylpentanamide (PubChem CID 65315116) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-phenylpentanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 65315116 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-phenylpentanamide |
| SMILES | CCC(C)C(C(=O)NC(CO)CO)c1ccccc1 |
| InChI | InChI=1S/C15H23NO3/c1-3-11(2)14(12-7-5-4-6-8-12)15(19)16-13(9-17)10-18/h4-8,11,13-14,17-18H,3,9-10H2,1-2H3,(H,16,19) |
| InChIKey | AJHIYAPWJXLEFL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |