About 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol
2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol (PubChem CID 65315305) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol |
| PubChem CID | 65315305 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol |
| SMILES | Nc1c(NC(CO)CO)ccc2scnc12 |
| InChI | InChI=1S/C10H13N3O2S/c11-9-7(13-6(3-14)4-15)1-2-8-10(9)12-5-16-8/h1-2,5-6,13-15H,3-4,11H2 |
| InChIKey | CACANRJGIVDHJD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol?
The IUPAC name of 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol (CID 65315305) is 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol.
What is the SMILES notation for 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol?
The canonical SMILES for 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol is Nc1c(NC(CO)CO)ccc2scnc12.
What is the InChIKey of 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol?
The InChIKey is CACANRJGIVDHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S/c11-9-7(13-6(3-14)4-15)1-2-8-10(9)12-5-16-8/h1-2,5-6,13-15H,3-4,11H2.
What are the key properties of 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol?
2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol has a molecular weight of 239.30 g/mol, XLogP of 0.64, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,3-benzothiazol-5-yl)amino]propane-1,3-diol is sourced from PubChem (CID 65315305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).