C12H15N3O3 — CID 65315452
2-(benzimidazol-1-yl)-N-(1,3-dihydroxypropan-2-yl)acetamide (PubChem CID 65315452) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N-(1,3-dihydroxypropan-2-yl)acetamide.
| Compound Name | 2-(benzimidazol-1-yl)-N-(1,3-dihydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 65315452 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N-(1,3-dihydroxypropan-2-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc21)NC(CO)CO |
| InChI | InChI=1S/C12H15N3O3/c16-6-9(7-17)14-12(18)5-15-8-13-10-3-1-2-4-11(10)15/h1-4,8-9,16-17H,5-7H2,(H,14,18) |
| InChIKey | OGDRGHKTIZYHAI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |