C11H15BrFNO2 — CID 65315700
2-[1-(3-bromo-4-fluorophenyl)ethylamino]propane-1,3-diol (PubChem CID 65315700) has the molecular formula C11H15BrFNO2 and a molecular weight of 292.15 g/mol. Its IUPAC name is 2-[1-(3-bromo-4-fluorophenyl)ethylamino]propane-1,3-diol.
| Compound Name | 2-[1-(3-bromo-4-fluorophenyl)ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65315700 |
| Molecular Formula | C11H15BrFNO2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[1-(3-bromo-4-fluorophenyl)ethylamino]propane-1,3-diol |
| SMILES | CC(NC(CO)CO)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H15BrFNO2/c1-7(14-9(5-15)6-16)8-2-3-11(13)10(12)4-8/h2-4,7,9,14-16H,5-6H2,1H3 |
| InChIKey | AUNRBNYFIBONLR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |