C17H25Cl2N — CID 65318007
4-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-amine (PubChem CID 65318007) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-amine.
| Compound Name | 4-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 65318007 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-amine |
| SMILES | CCCCC1CCC(N)(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H25Cl2N/c1-2-3-4-13-7-9-17(20,10-8-13)12-14-11-15(18)5-6-16(14)19/h5-6,11,13H,2-4,7-10,12,20H2,1H3 |
| InChIKey | AONPYXAYGSSOQS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |