C13H13Cl3N2 — CID 65318538
4-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]-3,5-dimethylpyrazole (PubChem CID 65318538) has the molecular formula C13H13Cl3N2 and a molecular weight of 303.62 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 4-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 65318538 |
| Molecular Formula | C13H13Cl3N2 |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 4-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cc2cc(Cl)ccc2Cl)c(C)c1CCl |
| InChI | InChI=1S/C13H13Cl3N2/c1-8-12(6-14)9(2)18(17-8)7-10-5-11(15)3-4-13(10)16/h3-5H,6-7H2,1-2H3 |
| InChIKey | LUEAXXLLMDSQLR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|