C16H22F2N2 — CID 65319085
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(2,3-difluorophenyl)ethanamine (PubChem CID 65319085) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(2,3-difluorophenyl)ethanamine.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(2,3-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 65319085 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(2,3-difluorophenyl)ethanamine |
| SMILES | NCC(c1cccc(F)c1F)N1CCCC2CCCC21 |
| InChI | InChI=1S/C16H22F2N2/c17-13-7-2-6-12(16(13)18)15(10-19)20-9-3-5-11-4-1-8-14(11)20/h2,6-7,11,14-15H,1,3-5,8-10,19H2 |
| InChIKey | AYKUOIHQEKYLSK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |