C13H22ClNO — CID 65319414
1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-chloropentan-1-one (PubChem CID 65319414) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-chloropentan-1-one.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-chloropentan-1-one |
|---|---|
| PubChem CID | 65319414 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-chloropentan-1-one |
| SMILES | O=C(CCCCCl)N1CCCC2CCCC21 |
| InChI | InChI=1S/C13H22ClNO/c14-9-2-1-8-13(16)15-10-4-6-11-5-3-7-12(11)15/h11-12H,1-10H2 |
| InChIKey | NZPMCXSZKXZJHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|