C14H19ClN2 — CID 65319793
1-[3-(chloromethyl)-2-pyridinyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine (PubChem CID 65319793) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-2-pyridinyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine.
| Compound Name | 1-[3-(chloromethyl)-2-pyridinyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 65319793 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[3-(chloromethyl)-2-pyridinyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
| SMILES | ClCc1cccnc1N1CCCC2CCCC21 |
| InChI | InChI=1S/C14H19ClN2/c15-10-12-5-2-8-16-14(12)17-9-3-6-11-4-1-7-13(11)17/h2,5,8,11,13H,1,3-4,6-7,9-10H2 |
| InChIKey | AUBOFMNUHUBJBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|