C11H16ClN3S — CID 65320709
4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chlorothiadiazole (PubChem CID 65320709) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chlorothiadiazole.
| Compound Name | 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chlorothiadiazole |
|---|---|
| PubChem CID | 65320709 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chlorothiadiazole |
| SMILES | Clc1snnc1CN1CCCC2CCCC21 |
| InChI | InChI=1S/C11H16ClN3S/c12-11-9(13-14-16-11)7-15-6-2-4-8-3-1-5-10(8)15/h8,10H,1-7H2 |
| InChIKey | JTFOTFHJIVRMQT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |