C18H11N3O5S2 — CID 6532103
N-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-nitrobenzamide (PubChem CID 6532103) has the molecular formula C18H11N3O5S2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-nitrobenzamide.
| Compound Name | N-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 6532103 |
| Molecular Formula | C18H11N3O5S2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | N-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-nitrobenzamide |
| SMILES | O=Cc1ccc(/C=C2\SC(=S)N(NC(=O)c3ccccc3[N+](=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C18H11N3O5S2/c22-10-12-7-5-11(6-8-12)9-15-17(24)20(18(27)28-15)19-16(23)13-3-1-2-4-14(13)21(25)26/h1-10H,(H,19,23)/b15-9- |
| InChIKey | KYACKYOKLMTYMV-DHDCSXOGSA-N |
| XLogP | 2.95 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|