C12H19N3O2S — CID 65321100
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-(2-amino-2-sulfanylideneethyl)-2-oxoacetamide (PubChem CID 65321100) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-(2-amino-2-sulfanylideneethyl)-2-oxoacetamide.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-(2-amino-2-sulfanylideneethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 65321100 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-(2-amino-2-sulfanylideneethyl)-2-oxoacetamide |
| SMILES | NC(=S)CNC(=O)C(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C12H19N3O2S/c13-10(18)7-14-11(16)12(17)15-6-2-4-8-3-1-5-9(8)15/h8-9H,1-7H2,(H2,13,18)(H,14,16) |
| InChIKey | WCHGGKXHCNWDPE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|