C17H17N3 — CID 653244
10-benzyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole (PubChem CID 653244) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 10-benzyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole.
| Compound Name | 10-benzyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 653244 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 10-benzyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole |
| SMILES | c1ccc(CN2C3=NCCCN3c3ccccc32)cc1 |
| InChI | InChI=1S/C17H17N3/c1-2-7-14(8-3-1)13-20-16-10-5-4-9-15(16)19-12-6-11-18-17(19)20/h1-5,7-10H,6,11-13H2 |
| InChIKey | VUVONONNFCOAPX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |