C18H21NO2 — CID 65324734
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3-(3-hydroxyprop-1-ynyl)phenyl]methanone (PubChem CID 65324734) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3-(3-hydroxyprop-1-ynyl)phenyl]methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3-(3-hydroxyprop-1-ynyl)phenyl]methanone |
|---|---|
| PubChem CID | 65324734 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3-(3-hydroxyprop-1-ynyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C#CCO)c1)N1CCCC2CCCC21 |
| InChI | InChI=1S/C18H21NO2/c20-12-4-6-14-5-1-8-16(13-14)18(21)19-11-3-9-15-7-2-10-17(15)19/h1,5,8,13,15,17,20H,2-3,7,9-12H2 |
| InChIKey | MGECTAQJNOAEBC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|