C15H20BrN3O — CID 65326686
1-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrazol-4-yl]-N-ethylethanamine (PubChem CID 65326686) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrazol-4-yl]-N-ethylethanamine.
| Compound Name | 1-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrazol-4-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 65326686 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrazol-4-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1cnn(Cc2cc(OC)ccc2Br)c1 |
| InChI | InChI=1S/C15H20BrN3O/c1-4-17-11(2)13-8-18-19(10-13)9-12-7-14(20-3)5-6-15(12)16/h5-8,10-11,17H,4,9H2,1-3H3 |
| InChIKey | MCIOWXUGMNMSNG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |