C22H20N4O5 — CID 6532700
(2Z)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-1-(4-imidazol-1-yl-3-nitrophenyl)ethanone (PubChem CID 6532700) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is (2Z)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-1-(4-imidazol-1-yl-3-nitrophenyl)ethanone.
| Compound Name | (2Z)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-1-(4-imidazol-1-yl-3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 6532700 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2Z)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-1-(4-imidazol-1-yl-3-nitrophenyl)ethanone |
| SMILES | COc1cc2c(cc1OC)/C(=C/C(=O)c1ccc(-n3ccnc3)c([N+](=O)[O-])c1)NCC2 |
| InChI | InChI=1S/C22H20N4O5/c1-30-21-10-14-5-6-24-17(16(14)11-22(21)31-2)12-20(27)15-3-4-18(19(9-15)26(28)29)25-8-7-23-13-25/h3-4,7-13,24H,5-6H2,1-2H3/b17-12- |
| InChIKey | IKBQXHGASUOHAO-ATVHPVEESA-N |
| XLogP | 3.17 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|