(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid

C17H12ClNO3 — CID 6532813

IUPAC(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid
SMILESO=C(O)C/C(=C\c1ccc(Cl)cc1)c1nc2ccccc2o1
InChIInChI=1S/C17H12ClNO3/c18-13-7-5-11(6-8-13)9-12(10-16(20)21)17-19-14-3-1-2-4-15(14)22-17/h1-9H,10H2,(H,20,21)/b12-9+
InChIKeyFWGQFLOXKPFMKA-FMIVXFBMSA-N
MW313.74 g/mol
LogP4.50
Rot. Bonds4

About (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid

(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid (PubChem CID 6532813) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid.

Molecular Properties

Compound Name(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid
PubChem CID6532813
Molecular FormulaC17H12ClNO3
Molecular Weight313.74 g/mol
Exact Mass313.05
IUPAC Name(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid
SMILESO=C(O)C/C(=C\c1ccc(Cl)cc1)c1nc2ccccc2o1
InChIInChI=1S/C17H12ClNO3/c18-13-7-5-11(6-8-13)9-12(10-16(20)21)17-19-14-3-1-2-4-15(14)22-17/h1-9H,10H2,(H,20,21)/b12-9+
InChIKeyFWGQFLOXKPFMKA-FMIVXFBMSA-N
XLogP4.50
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.74
LogP ≤ 54.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid?
The IUPAC name of (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid (CID 6532813) is (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid.
What is the SMILES notation for (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid?
The canonical SMILES for (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid is O=C(O)C/C(=C\c1ccc(Cl)cc1)c1nc2ccccc2o1.
What is the InChIKey of (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid?
The InChIKey is FWGQFLOXKPFMKA-FMIVXFBMSA-N. The full InChI is InChI=1S/C17H12ClNO3/c18-13-7-5-11(6-8-13)9-12(10-16(20)21)17-19-14-3-1-2-4-15(14)22-17/h1-9H,10H2,(H,20,21)/b12-9+.
What are the key properties of (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid?
(E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid has a molecular weight of 313.74 g/mol, XLogP of 4.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,3-benzoxazol-2-yl)-4-(4-chlorophenyl)but-3-enoic acid is sourced from PubChem (CID 6532813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).