C12H16FNO — CID 65328286
1-(3-fluorophenyl)-N-methyl-1-(oxolan-2-yl)methanamine (PubChem CID 65328286) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-methyl-1-(oxolan-2-yl)methanamine.
| Compound Name | 1-(3-fluorophenyl)-N-methyl-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 65328286 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(3-fluorophenyl)-N-methyl-1-(oxolan-2-yl)methanamine |
| SMILES | CNC(c1cccc(F)c1)C1CCCO1 |
| InChI | InChI=1S/C12H16FNO/c1-14-12(11-6-3-7-15-11)9-4-2-5-10(13)8-9/h2,4-5,8,11-12,14H,3,6-7H2,1H3 |
| InChIKey | NLRJOTXOEOAXLC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |