C10H16N2O3 — CID 65328398
1-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-ol (PubChem CID 65328398) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-ol.
| Compound Name | 1-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 65328398 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-ol |
| SMILES | CCC(O)Cc1nc(C2CCCO2)no1 |
| InChI | InChI=1S/C10H16N2O3/c1-2-7(13)6-9-11-10(12-15-9)8-4-3-5-14-8/h7-8,13H,2-6H2,1H3 |
| InChIKey | WCFSZGWBWDYDFV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |