C19H21N3O3S — CID 6532845
1-[(5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 6532845) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[(5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 6532845 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[(5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC1Cc2cc(/C=C3/SC(N4CCC(C(N)=O)CC4)=NC3=O)ccc2O1 |
| InChI | InChI=1S/C19H21N3O3S/c1-11-8-14-9-12(2-3-15(14)25-11)10-16-18(24)21-19(26-16)22-6-4-13(5-7-22)17(20)23/h2-3,9-11,13H,4-8H2,1H3,(H2,20,23)/b16-10+ |
| InChIKey | NOKPLNUWQYKIPV-MHWRWJLKSA-N |
| XLogP | 2.18 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|