About 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine
1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine (PubChem CID 65328987) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine.
Molecular Properties
| Compound Name | 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine |
| PubChem CID | 65328987 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine |
| SMILES | CC(N)(c1ccccc1)c1nc(C2CCOCC2)no1 |
| InChI | InChI=1S/C15H19N3O2/c1-15(16,12-5-3-2-4-6-12)14-17-13(18-20-14)11-7-9-19-10-8-11/h2-6,11H,7-10,16H2,1H3 |
| InChIKey | XHAHPZWDEHQUKO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine?
The IUPAC name of 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine (CID 65328987) is 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine.
What is the SMILES notation for 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine?
The canonical SMILES for 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine is CC(N)(c1ccccc1)c1nc(C2CCOCC2)no1.
What is the InChIKey of 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine?
The InChIKey is XHAHPZWDEHQUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-15(16,12-5-3-2-4-6-12)14-17-13(18-20-14)11-7-9-19-10-8-11/h2-6,11H,7-10,16H2,1H3.
What are the key properties of 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine?
1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine has a molecular weight of 273.34 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine is sourced from PubChem (CID 65328987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).