C12H19N3O — CID 65329120
N-[[2-(oxolan-3-yl)pyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 65329120) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[[2-(oxolan-3-yl)pyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(oxolan-3-yl)pyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65329120 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-[[2-(oxolan-3-yl)pyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C2CCOC2)nc1 |
| InChI | InChI=1S/C12H19N3O/c1-2-4-13-6-10-7-14-12(15-8-10)11-3-5-16-9-11/h7-8,11,13H,2-6,9H2,1H3 |
| InChIKey | HDDQDLYMHICQAQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|