C16H18N2O4S4 — CID 6533001
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 6533001) has the molecular formula C16H18N2O4S4 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6533001 |
| Molecular Formula | C16H18N2O4S4 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CC(C(=O)N(C)C1CCS(=O)(=O)C1)N1C(=O)/C(=C/c2cccs2)SC1=S |
| InChI | InChI=1S/C16H18N2O4S4/c1-10(14(19)17(2)11-5-7-26(21,22)9-11)18-15(20)13(25-16(18)23)8-12-4-3-6-24-12/h3-4,6,8,10-11H,5,7,9H2,1-2H3/b13-8- |
| InChIKey | ICQBAQJFAJYLTN-JYRVWZFOSA-N |
| XLogP | 1.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|