C13H21N3O2 — CID 65332435
1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine (PubChem CID 65332435) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine.
| Compound Name | 1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 65332435 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-amine |
| SMILES | NC1(c2nc(C3CCCOC3)no2)CCCCC1 |
| InChI | InChI=1S/C13H21N3O2/c14-13(6-2-1-3-7-13)12-15-11(16-18-12)10-5-4-8-17-9-10/h10H,1-9,14H2 |
| InChIKey | MFJHAKFNSDELIM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |